C11H15N3O — CID 104626797
N-(furan-3-ylmethyl)-2-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 104626797) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-(furan-3-ylmethyl)-2-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104626797 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-2-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1ccc(CCNCc2ccoc2)n1 |
| InChI | InChI=1S/C11H15N3O/c1-14-6-3-11(13-14)2-5-12-8-10-4-7-15-9-10/h3-4,6-7,9,12H,2,5,8H2,1H3 |
| InChIKey | KXSVMWMUWDWIJD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|