C17H25N3S — CID 43769127
N,N-diethyl-5-[(2-phenylpropylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 43769127) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is N,N-diethyl-5-[(2-phenylpropylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[(2-phenylpropylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43769127 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N,N-diethyl-5-[(2-phenylpropylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNCC(C)c2ccccc2)s1 |
| InChI | InChI=1S/C17H25N3S/c1-4-20(5-2)17-19-13-16(21-17)12-18-11-14(3)15-9-7-6-8-10-15/h6-10,13-14,18H,4-5,11-12H2,1-3H3 |
| InChIKey | JVKMLVIADGWLDI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |