C7H11IN2OS — CID 125142780
(2S)-1-[(5-iodo-1,3-thiazol-2-yl)methylamino]propan-2-ol (PubChem CID 125142780) has the molecular formula C7H11IN2OS and a molecular weight of 298.15 g/mol. Its IUPAC name is (2S)-1-[(5-iodo-1,3-thiazol-2-yl)methylamino]propan-2-ol.
| Compound Name | (2S)-1-[(5-iodo-1,3-thiazol-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 125142780 |
| Molecular Formula | C7H11IN2OS |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | (2S)-1-[(5-iodo-1,3-thiazol-2-yl)methylamino]propan-2-ol |
| SMILES | C[C@H](O)CNCc1ncc(I)s1 |
| InChI | InChI=1S/C7H11IN2OS/c1-5(11)2-9-4-7-10-3-6(8)12-7/h3,5,9,11H,2,4H2,1H3/t5-/m0/s1 |
| InChIKey | HGWCIDRPAMUAGB-YFKPBYRVSA-N |
| XLogP | 1.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|