C9H13IN2S2 — CID 130541239
N-[(5-iodo-1,3-thiazol-2-yl)methyl]thian-4-amine (PubChem CID 130541239) has the molecular formula C9H13IN2S2 and a molecular weight of 340.26 g/mol. Its IUPAC name is N-[(5-iodo-1,3-thiazol-2-yl)methyl]thian-4-amine.
| Compound Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 130541239 |
| Molecular Formula | C9H13IN2S2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]thian-4-amine |
| SMILES | Ic1cnc(CNC2CCSCC2)s1 |
| InChI | InChI=1S/C9H13IN2S2/c10-8-5-12-9(14-8)6-11-7-1-3-13-4-2-7/h5,7,11H,1-4,6H2 |
| InChIKey | VZJHOSSCEOTXBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|