C9H16N4S — CID 103884514
N-[(1-methyl-1,2,4-triazol-3-yl)methyl]thian-4-amine (PubChem CID 103884514) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[(1-methyl-1,2,4-triazol-3-yl)methyl]thian-4-amine.
| Compound Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 103884514 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]thian-4-amine |
| SMILES | Cn1cnc(CNC2CCSCC2)n1 |
| InChI | InChI=1S/C9H16N4S/c1-13-7-11-9(12-13)6-10-8-2-4-14-5-3-8/h7-8,10H,2-6H2,1H3 |
| InChIKey | QESGYOZIWOIKRJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |