About (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol
(2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol (PubChem CID 154843998) has the molecular formula C7H11ClN2OS
and a molecular weight of 206.70 g/mol. Its IUPAC name is (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol |
| PubChem CID | 154843998 |
| Molecular Formula | C7H11ClN2OS |
| Molecular Weight | 206.70 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol |
| SMILES | C[C@H](O)CNCc1nc(Cl)cs1 |
| InChI | InChI=1S/C7H11ClN2OS/c1-5(11)2-9-3-7-10-6(8)4-12-7/h4-5,9,11H,2-3H2,1H3/t5-/m0/s1 |
| InChIKey | KJJZNVCLSSSVDP-YFKPBYRVSA-N |
| XLogP | 1.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol?
The IUPAC name of (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol (CID 154843998) is (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol.
What is the SMILES notation for (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol?
The canonical SMILES for (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol is C[C@H](O)CNCc1nc(Cl)cs1.
What is the InChIKey of (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol?
The InChIKey is KJJZNVCLSSSVDP-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11ClN2OS/c1-5(11)2-9-3-7-10-6(8)4-12-7/h4-5,9,11H,2-3H2,1H3/t5-/m0/s1.
What are the key properties of (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol?
(2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol has a molecular weight of 206.70 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(4-chloro-1,3-thiazol-2-yl)methylamino]propan-2-ol is sourced from PubChem (CID 154843998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).