C11H18BrNOS2 — CID 115750427
N-[(4-bromo-5-methoxythiophen-2-yl)methyl]-4-methylsulfanylbutan-2-amine (PubChem CID 115750427) has the molecular formula C11H18BrNOS2 and a molecular weight of 324.31 g/mol. Its IUPAC name is N-[(4-bromo-5-methoxythiophen-2-yl)methyl]-4-methylsulfanylbutan-2-amine.
| Compound Name | N-[(4-bromo-5-methoxythiophen-2-yl)methyl]-4-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 115750427 |
| Molecular Formula | C11H18BrNOS2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-[(4-bromo-5-methoxythiophen-2-yl)methyl]-4-methylsulfanylbutan-2-amine |
| SMILES | COc1sc(CNC(C)CCSC)cc1Br |
| InChI | InChI=1S/C11H18BrNOS2/c1-8(4-5-15-3)13-7-9-6-10(12)11(14-2)16-9/h6,8,13H,4-5,7H2,1-3H3 |
| InChIKey | UFINYFZARCFGFW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |