C16H24BrNO4 — CID 122128133
2-[[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122128133) has the molecular formula C16H24BrNO4 and a molecular weight of 374.28 g/mol. Its IUPAC name is 2-[[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122128133 |
| Molecular Formula | C16H24BrNO4 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-[[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CCOc1cc(CNCC(CC(C)C)C(=O)O)cc(Br)c1O |
| InChI | InChI=1S/C16H24BrNO4/c1-4-22-14-7-11(6-13(17)15(14)19)8-18-9-12(16(20)21)5-10(2)3/h6-7,10,12,18-19H,4-5,8-9H2,1-3H3,(H,20,21) |
| InChIKey | CKCNHPITVLKXEW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |