C16H24FNO2 — CID 122073363
2-[[(2-ethyl-6-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122073363) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is 2-[[(2-ethyl-6-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(2-ethyl-6-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122073363 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-[[(2-ethyl-6-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CCc1cccc(F)c1CNCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H24FNO2/c1-4-12-6-5-7-15(17)14(12)10-18-9-13(16(19)20)8-11(2)3/h5-7,11,13,18H,4,8-10H2,1-3H3,(H,19,20) |
| InChIKey | ZEJXJVUCPBFTGK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |