C15H19F4NO3 — CID 122073360
2-[[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122073360) has the molecular formula C15H19F4NO3 and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-[[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122073360 |
| Molecular Formula | C15H19F4NO3 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1c(F)cccc1OC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H19F4NO3/c1-9(2)6-10(14(21)22)7-20-8-11-12(16)4-3-5-13(11)23-15(17,18)19/h3-5,9-10,20H,6-8H2,1-2H3,(H,21,22) |
| InChIKey | NOIKZJHUFUWFRU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |