C10H10F4N2O2 — CID 100756707
2-[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]acetamide (PubChem CID 100756707) has the molecular formula C10H10F4N2O2 and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]acetamide.
| Compound Name | 2-[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]acetamide |
|---|---|
| PubChem CID | 100756707 |
| Molecular Formula | C10H10F4N2O2 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[[2-fluoro-6-(trifluoromethoxy)phenyl]methylamino]acetamide |
| SMILES | NC(=O)CNCc1c(F)cccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F4N2O2/c11-7-2-1-3-8(18-10(12,13)14)6(7)4-16-5-9(15)17/h1-3,16H,4-5H2,(H2,15,17) |
| InChIKey | POWJNDSBFOKTQG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |