C19H22BrFN2O2 — CID 114068440
tert-butyl N-[3-[1-(2-bromo-4-fluorophenyl)ethylamino]phenyl]carbamate (PubChem CID 114068440) has the molecular formula C19H22BrFN2O2 and a molecular weight of 409.30 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2-bromo-4-fluorophenyl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(2-bromo-4-fluorophenyl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 114068440 |
| Molecular Formula | C19H22BrFN2O2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | tert-butyl N-[3-[1-(2-bromo-4-fluorophenyl)ethylamino]phenyl]carbamate |
| SMILES | CC(Nc1cccc(NC(=O)OC(C)(C)C)c1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C19H22BrFN2O2/c1-12(16-9-8-13(21)10-17(16)20)22-14-6-5-7-15(11-14)23-18(24)25-19(2,3)4/h5-12,22H,1-4H3,(H,23,24) |
| InChIKey | MTBSOHMFHRQEFB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |