C19H22F2N2O2 — CID 114058208
tert-butyl N-[3-[1-(2,3-difluorophenyl)ethylamino]phenyl]carbamate (PubChem CID 114058208) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2,3-difluorophenyl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(2,3-difluorophenyl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 114058208 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl N-[3-[1-(2,3-difluorophenyl)ethylamino]phenyl]carbamate |
| SMILES | CC(Nc1cccc(NC(=O)OC(C)(C)C)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C19H22F2N2O2/c1-12(15-9-6-10-16(20)17(15)21)22-13-7-5-8-14(11-13)23-18(24)25-19(2,3)4/h5-12,22H,1-4H3,(H,23,24) |
| InChIKey | SZNAKLWIEGSVDF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |