C10H17NS2 — CID 63993484
N-(2-methylsulfanylethyl)-1-(3-methylthiophen-2-yl)ethanamine (PubChem CID 63993484) has the molecular formula C10H17NS2 and a molecular weight of 215.39 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-1-(3-methylthiophen-2-yl)ethanamine.
| Compound Name | N-(2-methylsulfanylethyl)-1-(3-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 63993484 |
| Molecular Formula | C10H17NS2 |
| Molecular Weight | 215.39 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-(2-methylsulfanylethyl)-1-(3-methylthiophen-2-yl)ethanamine |
| SMILES | CSCCNC(C)c1sccc1C |
| InChI | InChI=1S/C10H17NS2/c1-8-4-6-13-10(8)9(2)11-5-7-12-3/h4,6,9,11H,5,7H2,1-3H3 |
| InChIKey | SMTSZIFSMNBMEE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|