C35H54O2 — CID 159785526
2-methyl-3-[(E)-7,11,15-trimethyl-3-(3-methylbutyl)hexadec-2-enyl]naphthalene-1,4-dione (PubChem CID 159785526) has the molecular formula C35H54O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is 2-methyl-3-[(E)-7,11,15-trimethyl-3-(3-methylbutyl)hexadec-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[(E)-7,11,15-trimethyl-3-(3-methylbutyl)hexadec-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 159785526 |
| Molecular Formula | C35H54O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | 2-methyl-3-[(E)-7,11,15-trimethyl-3-(3-methylbutyl)hexadec-2-enyl]naphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\CCCC(C)CCCC(C)CCCC(C)C)CCC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H54O2/c1-25(2)13-10-14-27(5)15-11-16-28(6)17-12-18-30(22-21-26(3)4)23-24-31-29(7)34(36)32-19-8-9-20-33(32)35(31)37/h8-9,19-20,23,25-28H,10-18,21-22,24H2,1-7H3/b30-23+ |
| InChIKey | MYJCXQZBDHUNGQ-JJKYIXSRSA-N |
| XLogP | 10.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|