C27H36O2 — CID 144956247
2-methyl-3-[(2E,7E)-3,5,5,8,10-pentamethylundeca-2,7-dienyl]naphthalene-1,4-dione (PubChem CID 144956247) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-methyl-3-[(2E,7E)-3,5,5,8,10-pentamethylundeca-2,7-dienyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[(2E,7E)-3,5,5,8,10-pentamethylundeca-2,7-dienyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 144956247 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 2-methyl-3-[(2E,7E)-3,5,5,8,10-pentamethylundeca-2,7-dienyl]naphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\C)CC(C)(C)C/C=C(\C)CC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H36O2/c1-18(2)16-19(3)14-15-27(6,7)17-20(4)12-13-22-21(5)25(28)23-10-8-9-11-24(23)26(22)29/h8-12,14,18H,13,15-17H2,1-7H3/b19-14+,20-12+ |
| InChIKey | NDDDMLYYOXJXNW-PIGBUECTSA-N |
| XLogP | 7.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|