C24H23N3O4 — CID 177371631
(3R)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-phenyl-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 177371631) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (3R)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-phenyl-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | (3R)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-phenyl-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 177371631 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3R)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-phenyl-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | O=C(COc1ccccc1)N[C@H](Cc1ccccc1)C(=O)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C24H23N3O4/c28-22(17-31-20-12-5-2-6-13-20)27-21(15-18-9-3-1-4-10-18)23(29)24(30)26-16-19-11-7-8-14-25-19/h1-14,21H,15-17H2,(H,26,30)(H,27,28)/t21-/m1/s1 |
| InChIKey | WNXKEIDVGXREHY-OAQYLSRUSA-N |
| XLogP | 2.07 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|