C15H22N2O5 — CID 3381137
4-(2,5-dimethoxyanilino)-4-oxo-2-(propylamino)butanoic acid (PubChem CID 3381137) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-(2,5-dimethoxyanilino)-4-oxo-2-(propylamino)butanoic acid.
| Compound Name | 4-(2,5-dimethoxyanilino)-4-oxo-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 3381137 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-(2,5-dimethoxyanilino)-4-oxo-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CC(=O)Nc1cc(OC)ccc1OC)C(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-4-7-16-12(15(19)20)9-14(18)17-11-8-10(21-2)5-6-13(11)22-3/h5-6,8,12,16H,4,7,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | FCRZXCUFWQOREX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |