C15H20F2N2O3 — CID 18581119
4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid (PubChem CID 18581119) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid.
| Compound Name | 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid |
|---|---|
| PubChem CID | 18581119 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid |
| SMILES | CCCCCNC(CC(=O)Nc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C15H20F2N2O3/c1-2-3-4-7-18-13(15(21)22)9-14(20)19-12-6-5-10(16)8-11(12)17/h5-6,8,13,18H,2-4,7,9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | CQRPXAYYJRONTL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|