4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid

C15H20F2N2O3 — CID 18581119

IUPAC4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid
SMILESCCCCCNC(CC(=O)Nc1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C15H20F2N2O3/c1-2-3-4-7-18-13(15(21)22)9-14(20)19-12-6-5-10(16)8-11(12)17/h5-6,8,13,18H,2-4,7,9H2,1H3,(H,19,20)(H,21,22)
InChIKeyCQRPXAYYJRONTL-UHFFFAOYSA-N
MW314.33 g/mol
LogP2.53
Rot. Bonds9

About 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid

4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid (PubChem CID 18581119) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid.

Molecular Properties

Compound Name4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid
PubChem CID18581119
Molecular FormulaC15H20F2N2O3
Molecular Weight314.33 g/mol
Exact Mass314.14
IUPAC Name4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid
SMILESCCCCCNC(CC(=O)Nc1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C15H20F2N2O3/c1-2-3-4-7-18-13(15(21)22)9-14(20)19-12-6-5-10(16)8-11(12)17/h5-6,8,13,18H,2-4,7,9H2,1H3,(H,19,20)(H,21,22)
InChIKeyCQRPXAYYJRONTL-UHFFFAOYSA-N
XLogP2.53
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.33
LogP ≤ 52.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid?
The IUPAC name of 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid (CID 18581119) is 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid.
What is the SMILES notation for 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid?
The canonical SMILES for 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid is CCCCCNC(CC(=O)Nc1ccc(F)cc1F)C(=O)O.
What is the InChIKey of 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid?
The InChIKey is CQRPXAYYJRONTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O3/c1-2-3-4-7-18-13(15(21)22)9-14(20)19-12-6-5-10(16)8-11(12)17/h5-6,8,13,18H,2-4,7,9H2,1H3,(H,19,20)(H,21,22).
What are the key properties of 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid?
4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid has a molecular weight of 314.33 g/mol, XLogP of 2.53, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluoroanilino)-4-oxo-2-(pentylamino)butanoic acid is sourced from PubChem (CID 18581119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).