C19H31N3O3 — CID 66491410
2-(butylamino)-4-[4-(diethylamino)-2-methylanilino]-4-oxobutanoic acid (PubChem CID 66491410) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-(butylamino)-4-[4-(diethylamino)-2-methylanilino]-4-oxobutanoic acid.
| Compound Name | 2-(butylamino)-4-[4-(diethylamino)-2-methylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 66491410 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-(butylamino)-4-[4-(diethylamino)-2-methylanilino]-4-oxobutanoic acid |
| SMILES | CCCCNC(CC(=O)Nc1ccc(N(CC)CC)cc1C)C(=O)O |
| InChI | InChI=1S/C19H31N3O3/c1-5-8-11-20-17(19(24)25)13-18(23)21-16-10-9-15(12-14(16)4)22(6-2)7-3/h9-10,12,17,20H,5-8,11,13H2,1-4H3,(H,21,23)(H,24,25) |
| InChIKey | CCCNEEXSRRQSJF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|