methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate

C14H20N2O3 — CID 103234166

IUPACmethyl 2-acetamido-3-(3,4-dimethylanilino)propanoate
SMILESCOC(=O)C(CNc1ccc(C)c(C)c1)NC(C)=O
InChIInChI=1S/C14H20N2O3/c1-9-5-6-12(7-10(9)2)15-8-13(14(18)19-4)16-11(3)17/h5-7,13,15H,8H2,1-4H3,(H,16,17)
InChIKeyILUWETNKKJVFKW-UHFFFAOYSA-N
MW264.32 g/mol
LogP1.39
Rot. Bonds5

About methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate

methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate (PubChem CID 103234166) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate.

Molecular Properties

Compound Namemethyl 2-acetamido-3-(3,4-dimethylanilino)propanoate
PubChem CID103234166
Molecular FormulaC14H20N2O3
Molecular Weight264.32 g/mol
Exact Mass264.15
IUPAC Namemethyl 2-acetamido-3-(3,4-dimethylanilino)propanoate
SMILESCOC(=O)C(CNc1ccc(C)c(C)c1)NC(C)=O
InChIInChI=1S/C14H20N2O3/c1-9-5-6-12(7-10(9)2)15-8-13(14(18)19-4)16-11(3)17/h5-7,13,15H,8H2,1-4H3,(H,16,17)
InChIKeyILUWETNKKJVFKW-UHFFFAOYSA-N
XLogP1.39
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate?
The IUPAC name of methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate (CID 103234166) is methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate.
What is the SMILES notation for methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate?
The canonical SMILES for methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate is COC(=O)C(CNc1ccc(C)c(C)c1)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate?
The InChIKey is ILUWETNKKJVFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-9-5-6-12(7-10(9)2)15-8-13(14(18)19-4)16-11(3)17/h5-7,13,15H,8H2,1-4H3,(H,16,17).
What are the key properties of methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate?
methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate has a molecular weight of 264.32 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate is sourced from PubChem (CID 103234166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).