C14H20N2O3 — CID 103234166
methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate (PubChem CID 103234166) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate.
| Compound Name | methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 103234166 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | methyl 2-acetamido-3-(3,4-dimethylanilino)propanoate |
| SMILES | COC(=O)C(CNc1ccc(C)c(C)c1)NC(C)=O |
| InChI | InChI=1S/C14H20N2O3/c1-9-5-6-12(7-10(9)2)15-8-13(14(18)19-4)16-11(3)17/h5-7,13,15H,8H2,1-4H3,(H,16,17) |
| InChIKey | ILUWETNKKJVFKW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |