C14H19NO4S — CID 65475192
methyl 2-acetamido-3-(3,4-dimethylphenyl)sulfinylpropanoate (PubChem CID 65475192) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,4-dimethylphenyl)sulfinylpropanoate.
| Compound Name | methyl 2-acetamido-3-(3,4-dimethylphenyl)sulfinylpropanoate |
|---|---|
| PubChem CID | 65475192 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 2-acetamido-3-(3,4-dimethylphenyl)sulfinylpropanoate |
| SMILES | COC(=O)C(CS(=O)c1ccc(C)c(C)c1)NC(C)=O |
| InChI | InChI=1S/C14H19NO4S/c1-9-5-6-12(7-10(9)2)20(18)8-13(14(17)19-4)15-11(3)16/h5-7,13H,8H2,1-4H3,(H,15,16) |
| InChIKey | ZTUYUAVFACJPLJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |