3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid

C12H16O3S — CID 61302341

IUPAC3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid
SMILESCc1ccc(S(=O)CC(C)C(=O)O)cc1C
InChIInChI=1S/C12H16O3S/c1-8-4-5-11(6-9(8)2)16(15)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14)
InChIKeyJDEOFAMKNJTQSQ-UHFFFAOYSA-N
MW240.32 g/mol
LogP2.13
Rot. Bonds4

About 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid

3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid (PubChem CID 61302341) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid
PubChem CID61302341
Molecular FormulaC12H16O3S
Molecular Weight240.32 g/mol
Exact Mass240.08
IUPAC Name3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid
SMILESCc1ccc(S(=O)CC(C)C(=O)O)cc1C
InChIInChI=1S/C12H16O3S/c1-8-4-5-11(6-9(8)2)16(15)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14)
InChIKeyJDEOFAMKNJTQSQ-UHFFFAOYSA-N
XLogP2.13
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.32
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid?
The IUPAC name of 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid (CID 61302341) is 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid.
What is the SMILES notation for 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid?
The canonical SMILES for 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid is Cc1ccc(S(=O)CC(C)C(=O)O)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid?
The InChIKey is JDEOFAMKNJTQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-8-4-5-11(6-9(8)2)16(15)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14).
What are the key properties of 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid?
3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid has a molecular weight of 240.32 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid is sourced from PubChem (CID 61302341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).