C12H16O3S — CID 61302341
3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid (PubChem CID 61302341) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid.
| Compound Name | 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61302341 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfinyl-2-methylpropanoic acid |
| SMILES | Cc1ccc(S(=O)CC(C)C(=O)O)cc1C |
| InChI | InChI=1S/C12H16O3S/c1-8-4-5-11(6-9(8)2)16(15)7-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H,13,14) |
| InChIKey | JDEOFAMKNJTQSQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |