C13H19NOS — CID 64659864
1-cyclopropyl-2-(3,4-dimethylphenyl)sulfinylethanamine (PubChem CID 64659864) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3,4-dimethylphenyl)sulfinylethanamine.
| Compound Name | 1-cyclopropyl-2-(3,4-dimethylphenyl)sulfinylethanamine |
|---|---|
| PubChem CID | 64659864 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-cyclopropyl-2-(3,4-dimethylphenyl)sulfinylethanamine |
| SMILES | Cc1ccc(S(=O)CC(N)C2CC2)cc1C |
| InChI | InChI=1S/C13H19NOS/c1-9-3-6-12(7-10(9)2)16(15)8-13(14)11-4-5-11/h3,6-7,11,13H,4-5,8,14H2,1-2H3 |
| InChIKey | XIXAQGUDZGLBOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |