3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid

C11H15NO3S — CID 64693818

IUPAC3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid
SMILESCc1ccc(S(=O)C(CN)C(=O)O)cc1C
InChIInChI=1S/C11H15NO3S/c1-7-3-4-9(5-8(7)2)16(15)10(6-12)11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14)
InChIKeyOOYMXCQEBMUICI-UHFFFAOYSA-N
MW241.31 g/mol
LogP0.82
Rot. Bonds4

About 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid

3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid (PubChem CID 64693818) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid.

Molecular Properties

Compound Name3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid
PubChem CID64693818
Molecular FormulaC11H15NO3S
Molecular Weight241.31 g/mol
Exact Mass241.08
IUPAC Name3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid
SMILESCc1ccc(S(=O)C(CN)C(=O)O)cc1C
InChIInChI=1S/C11H15NO3S/c1-7-3-4-9(5-8(7)2)16(15)10(6-12)11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14)
InChIKeyOOYMXCQEBMUICI-UHFFFAOYSA-N
XLogP0.82
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.31
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid?
The IUPAC name of 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid (CID 64693818) is 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid.
What is the SMILES notation for 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid?
The canonical SMILES for 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid is Cc1ccc(S(=O)C(CN)C(=O)O)cc1C.
What is the InChIKey of 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid?
The InChIKey is OOYMXCQEBMUICI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-7-3-4-9(5-8(7)2)16(15)10(6-12)11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14).
What are the key properties of 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid?
3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid has a molecular weight of 241.31 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3,4-dimethylphenyl)sulfinylpropanoic acid is sourced from PubChem (CID 64693818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).