C12H15NOS — CID 64690248
3-(3,4-dimethylphenyl)sulfinylbutanenitrile (PubChem CID 64690248) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfinylbutanenitrile.
| Compound Name | 3-(3,4-dimethylphenyl)sulfinylbutanenitrile |
|---|---|
| PubChem CID | 64690248 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfinylbutanenitrile |
| SMILES | Cc1ccc(S(=O)C(C)CC#N)cc1C |
| InChI | InChI=1S/C12H15NOS/c1-9-4-5-12(8-10(9)2)15(14)11(3)6-7-13/h4-5,8,11H,6H2,1-3H3 |
| InChIKey | ONJXKLVEYMLZFK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |