C10H9F2NOS — CID 64691751
3-(2,5-difluorophenyl)sulfinylbutanenitrile (PubChem CID 64691751) has the molecular formula C10H9F2NOS and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)sulfinylbutanenitrile.
| Compound Name | 3-(2,5-difluorophenyl)sulfinylbutanenitrile |
|---|---|
| PubChem CID | 64691751 |
| Molecular Formula | C10H9F2NOS |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(2,5-difluorophenyl)sulfinylbutanenitrile |
| SMILES | CC(CC#N)S(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H9F2NOS/c1-7(4-5-13)15(14)10-6-8(11)2-3-9(10)12/h2-3,6-7H,4H2,1H3 |
| InChIKey | PJQVVTFNWQTOTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |