methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate

C12H13Cl2NO4S — CID 115477541

IUPACmethyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate
SMILESCOC(=O)C(CS(=O)c1c(Cl)cccc1Cl)NC(C)=O
InChIInChI=1S/C12H13Cl2NO4S/c1-7(16)15-10(12(17)19-2)6-20(18)11-8(13)4-3-5-9(11)14/h3-5,10H,6H2,1-2H3,(H,15,16)
InChIKeyWNKZNVBRQRDHFN-UHFFFAOYSA-N
MW338.21 g/mol
LogP1.78
Rot. Bonds5

About methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate

methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate (PubChem CID 115477541) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate.

Molecular Properties

Compound Namemethyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate
PubChem CID115477541
Molecular FormulaC12H13Cl2NO4S
Molecular Weight338.21 g/mol
Exact Mass336.99
IUPAC Namemethyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate
SMILESCOC(=O)C(CS(=O)c1c(Cl)cccc1Cl)NC(C)=O
InChIInChI=1S/C12H13Cl2NO4S/c1-7(16)15-10(12(17)19-2)6-20(18)11-8(13)4-3-5-9(11)14/h3-5,10H,6H2,1-2H3,(H,15,16)
InChIKeyWNKZNVBRQRDHFN-UHFFFAOYSA-N
XLogP1.78
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.21
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate?
The IUPAC name of methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate (CID 115477541) is methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate.
What is the SMILES notation for methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate?
The canonical SMILES for methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate is COC(=O)C(CS(=O)c1c(Cl)cccc1Cl)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate?
The InChIKey is WNKZNVBRQRDHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO4S/c1-7(16)15-10(12(17)19-2)6-20(18)11-8(13)4-3-5-9(11)14/h3-5,10H,6H2,1-2H3,(H,15,16).
What are the key properties of methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate?
methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate has a molecular weight of 338.21 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(2,6-dichlorophenyl)sulfinylpropanoate is sourced from PubChem (CID 115477541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).