C14H20N2O5 — CID 103232986
methyl 2-acetamido-3-(3,4-dimethoxyanilino)propanoate (PubChem CID 103232986) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,4-dimethoxyanilino)propanoate.
| Compound Name | methyl 2-acetamido-3-(3,4-dimethoxyanilino)propanoate |
|---|---|
| PubChem CID | 103232986 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | methyl 2-acetamido-3-(3,4-dimethoxyanilino)propanoate |
| SMILES | COC(=O)C(CNc1ccc(OC)c(OC)c1)NC(C)=O |
| InChI | InChI=1S/C14H20N2O5/c1-9(17)16-11(14(18)21-4)8-15-10-5-6-12(19-2)13(7-10)20-3/h5-7,11,15H,8H2,1-4H3,(H,16,17) |
| InChIKey | YEYHJTIEOWWALC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|