C13H13BrN2O2 — CID 63961087
6-bromo-N-(3,4-dimethoxyphenyl)pyridin-2-amine (PubChem CID 63961087) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 6-bromo-N-(3,4-dimethoxyphenyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-(3,4-dimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63961087 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 6-bromo-N-(3,4-dimethoxyphenyl)pyridin-2-amine |
| SMILES | COc1ccc(Nc2cccc(Br)n2)cc1OC |
| InChI | InChI=1S/C13H13BrN2O2/c1-17-10-7-6-9(8-11(10)18-2)15-13-5-3-4-12(14)16-13/h3-8H,1-2H3,(H,15,16) |
| InChIKey | XFPGQTDORKAUPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|