C13H16N4O4S — CID 113048905
N-[6-(3,4-dimethoxyanilino)pyridazin-3-yl]methanesulfonamide (PubChem CID 113048905) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[6-(3,4-dimethoxyanilino)pyridazin-3-yl]methanesulfonamide.
| Compound Name | N-[6-(3,4-dimethoxyanilino)pyridazin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113048905 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[6-(3,4-dimethoxyanilino)pyridazin-3-yl]methanesulfonamide |
| SMILES | COc1ccc(Nc2ccc(NS(C)(=O)=O)nn2)cc1OC |
| InChI | InChI=1S/C13H16N4O4S/c1-20-10-5-4-9(8-11(10)21-2)14-12-6-7-13(16-15-12)17-22(3,18)19/h4-8H,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | GKTIDROJHPBKFO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |