C14H19N5O4S — CID 113048909
3-(3,4-dimethoxyanilino)-6-(dimethylsulfamoylamino)pyridazine (PubChem CID 113048909) has the molecular formula C14H19N5O4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-6-(dimethylsulfamoylamino)pyridazine.
| Compound Name | 3-(3,4-dimethoxyanilino)-6-(dimethylsulfamoylamino)pyridazine |
|---|---|
| PubChem CID | 113048909 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-6-(dimethylsulfamoylamino)pyridazine |
| SMILES | COc1ccc(Nc2ccc(NS(=O)(=O)N(C)C)nn2)cc1OC |
| InChI | InChI=1S/C14H19N5O4S/c1-19(2)24(20,21)18-14-8-7-13(16-17-14)15-10-5-6-11(22-3)12(9-10)23-4/h5-9H,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | JNJRHGNZVDDEGS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |