C14H18ClN5O3S — CID 113051006
3-(4-chloro-2-methoxy-5-methylanilino)-6-(dimethylsulfamoylamino)pyridazine (PubChem CID 113051006) has the molecular formula C14H18ClN5O3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-5-methylanilino)-6-(dimethylsulfamoylamino)pyridazine.
| Compound Name | 3-(4-chloro-2-methoxy-5-methylanilino)-6-(dimethylsulfamoylamino)pyridazine |
|---|---|
| PubChem CID | 113051006 |
| Molecular Formula | C14H18ClN5O3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-(4-chloro-2-methoxy-5-methylanilino)-6-(dimethylsulfamoylamino)pyridazine |
| SMILES | COc1cc(Cl)c(C)cc1Nc1ccc(NS(=O)(=O)N(C)C)nn1 |
| InChI | InChI=1S/C14H18ClN5O3S/c1-9-7-11(12(23-4)8-10(9)15)16-13-5-6-14(18-17-13)19-24(21,22)20(2)3/h5-8H,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | FJJMCUJGBRYOIJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |