C12H13Cl2N5O2S — CID 113050806
3-(2,4-dichloroanilino)-6-(dimethylsulfamoylamino)pyridazine (PubChem CID 113050806) has the molecular formula C12H13Cl2N5O2S and a molecular weight of 362.24 g/mol. Its IUPAC name is 3-(2,4-dichloroanilino)-6-(dimethylsulfamoylamino)pyridazine.
| Compound Name | 3-(2,4-dichloroanilino)-6-(dimethylsulfamoylamino)pyridazine |
|---|---|
| PubChem CID | 113050806 |
| Molecular Formula | C12H13Cl2N5O2S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-(2,4-dichloroanilino)-6-(dimethylsulfamoylamino)pyridazine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(Nc2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C12H13Cl2N5O2S/c1-19(2)22(20,21)18-12-6-5-11(16-17-12)15-10-4-3-8(13)7-9(10)14/h3-7H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ZMQBIKJJCUEHQY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |