C15H19N5O4S — CID 113051086
ethyl 2-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate (PubChem CID 113051086) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is ethyl 2-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 113051086 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | ethyl 2-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ccc(NS(=O)(=O)N(C)C)nn1 |
| InChI | InChI=1S/C15H19N5O4S/c1-4-24-15(21)11-7-5-6-8-12(11)16-13-9-10-14(18-17-13)19-25(22,23)20(2)3/h5-10H,4H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | SIIRLTINGHLWGZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |