C19H19N5O2 — CID 112962552
ethyl 2-[[3-(N-methylanilino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112962552) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 2-[[3-(N-methylanilino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | ethyl 2-[[3-(N-methylanilino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112962552 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethyl 2-[[3-(N-methylanilino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1cnnc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C19H19N5O2/c1-3-26-18(25)15-11-7-8-12-16(15)21-17-13-20-23-19(22-17)24(2)14-9-5-4-6-10-14/h4-13H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | XWITXUMHOJMKAE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |