C20H17FN4O3 — CID 113051053
ethyl 2-[[6-[(4-fluorobenzoyl)amino]pyridazin-3-yl]amino]benzoate (PubChem CID 113051053) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is ethyl 2-[[6-[(4-fluorobenzoyl)amino]pyridazin-3-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-[(4-fluorobenzoyl)amino]pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 113051053 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 2-[[6-[(4-fluorobenzoyl)amino]pyridazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ccc(NC(=O)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C20H17FN4O3/c1-2-28-20(27)15-5-3-4-6-16(15)22-17-11-12-18(25-24-17)23-19(26)13-7-9-14(21)10-8-13/h3-12H,2H2,1H3,(H,22,24)(H,23,25,26) |
| InChIKey | UWGYUZUDROJXEC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |