C14H17N5O4S — CID 113049450
methyl 3-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate (PubChem CID 113049450) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is methyl 3-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 113049450 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | methyl 3-[[6-(dimethylsulfamoylamino)pyridazin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ccc(NS(=O)(=O)N(C)C)nn2)c1 |
| InChI | InChI=1S/C14H17N5O4S/c1-19(2)24(21,22)18-13-8-7-12(16-17-13)15-11-6-4-5-10(9-11)14(20)23-3/h4-9H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | CLTXEKXAPSNOJD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |