C13H16N4O2S — CID 113046385
N-[6-(3,4-dimethylanilino)pyridazin-3-yl]methanesulfonamide (PubChem CID 113046385) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[6-(3,4-dimethylanilino)pyridazin-3-yl]methanesulfonamide.
| Compound Name | N-[6-(3,4-dimethylanilino)pyridazin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113046385 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[6-(3,4-dimethylanilino)pyridazin-3-yl]methanesulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NS(C)(=O)=O)nn2)cc1C |
| InChI | InChI=1S/C13H16N4O2S/c1-9-4-5-11(8-10(9)2)14-12-6-7-13(16-15-12)17-20(3,18)19/h4-8H,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | GYVIHNFMUQSSPQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |