C11H10BrFN4 — CID 104775528
6-N-(3-bromo-4-fluorophenyl)pyridine-2,3,6-triamine (PubChem CID 104775528) has the molecular formula C11H10BrFN4 and a molecular weight of 297.13 g/mol. Its IUPAC name is 6-N-(3-bromo-4-fluorophenyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(3-bromo-4-fluorophenyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 104775528 |
| Molecular Formula | C11H10BrFN4 |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 6-N-(3-bromo-4-fluorophenyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(Nc2ccc(F)c(Br)c2)nc1N |
| InChI | InChI=1S/C11H10BrFN4/c12-7-5-6(1-2-8(7)13)16-10-4-3-9(14)11(15)17-10/h1-5H,14H2,(H3,15,16,17) |
| InChIKey | OAPYAXGCSDJVHC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |