C11H8F4N4 — CID 107643324
6-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,3,6-triamine (PubChem CID 107643324) has the molecular formula C11H8F4N4 and a molecular weight of 272.20 g/mol. Its IUPAC name is 6-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 107643324 |
| Molecular Formula | C11H8F4N4 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 6-N-(2,3,5,6-tetrafluorophenyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(Nc2c(F)c(F)cc(F)c2F)nc1N |
| InChI | InChI=1S/C11H8F4N4/c12-4-3-5(13)9(15)10(8(4)14)18-7-2-1-6(16)11(17)19-7/h1-3H,16H2,(H3,17,18,19) |
| InChIKey | IEHRGAMHYBCISM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|