C11H10F2N4 — CID 79827013
6-N-(2,3-difluorophenyl)pyridine-2,3,6-triamine (PubChem CID 79827013) has the molecular formula C11H10F2N4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 6-N-(2,3-difluorophenyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(2,3-difluorophenyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79827013 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 6-N-(2,3-difluorophenyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(Nc2cccc(F)c2F)nc1N |
| InChI | InChI=1S/C11H10F2N4/c12-6-2-1-3-8(10(6)13)16-9-5-4-7(14)11(15)17-9/h1-5H,14H2,(H3,15,16,17) |
| InChIKey | SZTCMWZFQBACOO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |