C20H18N4O2S — CID 58910748
N-(3,4-dimethoxyphenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 58910748) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910748 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ccc(-n4ccnc4)cc3)cs2)cc1OC |
| InChI | InChI=1S/C20H18N4O2S/c1-25-18-8-5-15(11-19(18)26-2)22-20-23-17(12-27-20)14-3-6-16(7-4-14)24-10-9-21-13-24/h3-13H,1-2H3,(H,22,23) |
| InChIKey | REURIGONAYJYNZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |