C18H13BrN4S — CID 58910449
N-(4-bromophenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 58910449) has the molecular formula C18H13BrN4S and a molecular weight of 397.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-bromophenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910449 |
| Molecular Formula | C18H13BrN4S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | N-(4-bromophenyl)-4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | Brc1ccc(Nc2nc(-c3ccc(-n4ccnc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H13BrN4S/c19-14-3-5-15(6-4-14)21-18-22-17(11-24-18)13-1-7-16(8-2-13)23-10-9-20-12-23/h1-12H,(H,21,22) |
| InChIKey | KDXKYMDPQORYEY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |