C19H14N6S — CID 58911089
4-(4-imidazol-1-ylphenyl)-N-(1H-indazol-3-yl)-1,3-thiazol-2-amine (PubChem CID 58911089) has the molecular formula C19H14N6S and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-(4-imidazol-1-ylphenyl)-N-(1H-indazol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-imidazol-1-ylphenyl)-N-(1H-indazol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58911089 |
| Molecular Formula | C19H14N6S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-(4-imidazol-1-ylphenyl)-N-(1H-indazol-3-yl)-1,3-thiazol-2-amine |
| SMILES | c1ccc2c(Nc3nc(-c4ccc(-n5ccnc5)cc4)cs3)n[nH]c2c1 |
| InChI | InChI=1S/C19H14N6S/c1-2-4-16-15(3-1)18(24-23-16)22-19-21-17(11-26-19)13-5-7-14(8-6-13)25-10-9-20-12-25/h1-12H,(H2,21,22,23,24) |
| InChIKey | BYNVFYWHLIUELP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |