C20H23N3S2 — CID 129173895
4-[(E)-1-[[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]prop-1-en-2-yl]-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine (PubChem CID 129173895) has the molecular formula C20H23N3S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 4-[(E)-1-[[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]prop-1-en-2-yl]-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[(E)-1-[[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]prop-1-en-2-yl]-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 129173895 |
| Molecular Formula | C20H23N3S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-[(E)-1-[[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]prop-1-en-2-yl]-N-(3-methylsulfanylphenyl)-1,3-thiazol-2-amine |
| SMILES | C/C=C\C=C/C(C)=N/C=C(\C)c1csc(Nc2cccc(SC)c2)n1 |
| InChI | InChI=1S/C20H23N3S2/c1-5-6-7-9-16(3)21-13-15(2)19-14-25-20(23-19)22-17-10-8-11-18(12-17)24-4/h5-14H,1-4H3,(H,22,23)/b6-5-,9-7-,15-13+,21-16+ |
| InChIKey | JLAUKYWILLHXHT-XMUQJGFPSA-N |
| XLogP | 6.56 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|