C10H8ClN5S — CID 154945790
(6-chloro-1,3-benzothiazol-2-yl)methylidenehydrazine;bis(formonitrile) (PubChem CID 154945790) has the molecular formula C10H8ClN5S and a molecular weight of 265.73 g/mol. Its IUPAC name is (6-chloro-1,3-benzothiazol-2-yl)methylidenehydrazine;bis(formonitrile).
| Compound Name | (6-chloro-1,3-benzothiazol-2-yl)methylidenehydrazine;bis(formonitrile) |
|---|---|
| PubChem CID | 154945790 |
| Molecular Formula | C10H8ClN5S |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | (6-chloro-1,3-benzothiazol-2-yl)methylidenehydrazine;bis(formonitrile) |
| SMILES | C#N.C#N.NN=Cc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C8H6ClN3S.2CHN/c9-5-1-2-6-7(3-5)13-8(12-6)4-11-10;2*1-2/h1-4H,10H2;2*1H |
| InChIKey | KSMYMWAYXJAEKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|