C18H14N2O3 — CID 10924785
4-methoxy-1-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione (PubChem CID 10924785) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-methoxy-1-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione.
| Compound Name | 4-methoxy-1-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione |
|---|---|
| PubChem CID | 10924785 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-methoxy-1-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione |
| SMILES | COc1cc2c(c3c1ccn3C)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C18H14N2O3/c1-19-9-8-12-14(23-2)10-13-15(16(12)19)18(22)20(17(13)21)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | ACZCTKPOMPZAMP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|