C26H22N2O2 — CID 102002840
1-[(3,5-dimethylphenyl)methyl]-4-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione (PubChem CID 102002840) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-4-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione.
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-4-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione |
|---|---|
| PubChem CID | 102002840 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-4-methyl-7-phenylpyrrolo[3,4-g]indole-6,8-dione |
| SMILES | Cc1cc(C)cc(Cn2ccc3c(C)cc4c(c32)C(=O)N(c2ccccc2)C4=O)c1 |
| InChI | InChI=1S/C26H22N2O2/c1-16-11-17(2)13-19(12-16)15-27-10-9-21-18(3)14-22-23(24(21)27)26(30)28(25(22)29)20-7-5-4-6-8-20/h4-14H,15H2,1-3H3 |
| InChIKey | ISKKBIZCDTYLME-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|