C19H18O3S — CID 136764898
(5S)-4-hydroxy-3,5-dimethyl-5-[(3-phenoxyphenyl)methyl]thiophen-2-one (PubChem CID 136764898) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (5S)-4-hydroxy-3,5-dimethyl-5-[(3-phenoxyphenyl)methyl]thiophen-2-one.
| Compound Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(3-phenoxyphenyl)methyl]thiophen-2-one |
|---|---|
| PubChem CID | 136764898 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(3-phenoxyphenyl)methyl]thiophen-2-one |
| SMILES | CC1=C(O)[C@](C)(Cc2cccc(Oc3ccccc3)c2)SC1=O |
| InChI | InChI=1S/C19H18O3S/c1-13-17(20)19(2,23-18(13)21)12-14-7-6-10-16(11-14)22-15-8-4-3-5-9-15/h3-11,20H,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | OXBOERUJWULYPV-IBGZPJMESA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|